C23H29F3N6O2 — CID 89471505
1-[(1S,2S,4R)-4-(tert-butylamino)-2-cyanocyclohexyl]-3-[4-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]anilino]pyrazole-4-carboxamide (PubChem CID 89471505) has the molecular formula C23H29F3N6O2 and a molecular weight of 478.52 g/mol. Its IUPAC name is 1-[(1S,2S,4R)-4-(tert-butylamino)-2-cyanocyclohexyl]-3-[4-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]anilino]pyrazole-4-carboxamide.
| Compound Name | 1-[(1S,2S,4R)-4-(tert-butylamino)-2-cyanocyclohexyl]-3-[4-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]anilino]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 89471505 |
| Molecular Formula | C23H29F3N6O2 |
| Molecular Weight | 478.52 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | 1-[(1S,2S,4R)-4-(tert-butylamino)-2-cyanocyclohexyl]-3-[4-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]anilino]pyrazole-4-carboxamide |
| SMILES | CC(C)(C)N[C@@H]1CC[C@H](n2cc(C(N)=O)c(Nc3ccc([C@H](O)C(F)(F)F)cc3)n2)[C@@H](C#N)C1 |
| InChI | InChI=1S/C23H29F3N6O2/c1-22(2,3)30-16-8-9-18(14(10-16)11-27)32-12-17(20(28)34)21(31-32)29-15-6-4-13(5-7-15)19(33)23(24,25)26/h4-7,12,14,16,18-19,30,33H,8-10H2,1-3H3,(H2,28,34)(H,29,31)/t14-,16-,18+,19+/m1/s1 |
| InChIKey | XAAGGNGZXUXQOD-JZGRTCEGSA-N |
| XLogP | 3.94 |
| TPSA | 128.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.52 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |