C15H16N6OS — CID 130284951
(E)-3-amino-2-[N'-[4-(pyridin-4-ylamino)sulfanylphenyl]carbamimidoyl]prop-2-enamide (PubChem CID 130284951) has the molecular formula C15H16N6OS and a molecular weight of 328.40 g/mol. Its IUPAC name is (E)-3-amino-2-[N'-[4-(pyridin-4-ylamino)sulfanylphenyl]carbamimidoyl]prop-2-enamide.
| Compound Name | (E)-3-amino-2-[N'-[4-(pyridin-4-ylamino)sulfanylphenyl]carbamimidoyl]prop-2-enamide |
|---|---|
| PubChem CID | 130284951 |
| Molecular Formula | C15H16N6OS |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | (E)-3-amino-2-[N'-[4-(pyridin-4-ylamino)sulfanylphenyl]carbamimidoyl]prop-2-enamide |
| SMILES | N/C=C(C(N)=O)\C(N)=N\c1ccc(SNc2ccncc2)cc1 |
| InChI | InChI=1S/C15H16N6OS/c16-9-13(15(18)22)14(17)20-10-1-3-12(4-2-10)23-21-11-5-7-19-8-6-11/h1-9H,16H2,(H2,17,20)(H2,18,22)(H,19,21)/b13-9+ |
| InChIKey | USOXVRJEBKQFGS-UKTHLTGXSA-N |
| XLogP | 1.52 |
| TPSA | 132.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|