C22H27FN6O — CID 137307737
(E)-2-[N'-(4-fluorophenyl)carbamimidoyl]-3-[[1-methyl-4-(pyridin-3-ylamino)cyclohexyl]amino]prop-2-enamide (PubChem CID 137307737) has the molecular formula C22H27FN6O and a molecular weight of 410.50 g/mol. Its IUPAC name is (E)-2-[N'-(4-fluorophenyl)carbamimidoyl]-3-[[1-methyl-4-(pyridin-3-ylamino)cyclohexyl]amino]prop-2-enamide.
| Compound Name | (E)-2-[N'-(4-fluorophenyl)carbamimidoyl]-3-[[1-methyl-4-(pyridin-3-ylamino)cyclohexyl]amino]prop-2-enamide |
|---|---|
| PubChem CID | 137307737 |
| Molecular Formula | C22H27FN6O |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | (E)-2-[N'-(4-fluorophenyl)carbamimidoyl]-3-[[1-methyl-4-(pyridin-3-ylamino)cyclohexyl]amino]prop-2-enamide |
| SMILES | CC1(N/C=C(C(N)=O)\C(N)=N\c2ccc(F)cc2)CCC(Nc2cccnc2)CC1 |
| InChI | InChI=1S/C22H27FN6O/c1-22(10-8-17(9-11-22)28-18-3-2-12-26-13-18)27-14-19(21(25)30)20(24)29-16-6-4-15(23)5-7-16/h2-7,12-14,17,27-28H,8-11H2,1H3,(H2,24,29)(H2,25,30)/b19-14+ |
| InChIKey | GCTGQTUFKPYFSN-XMHGGMMESA-N |
| XLogP | 2.98 |
| TPSA | 118.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|