C23H28F2N6O — CID 123292643
3-amino-2-[[1-(aminomethyl)-4-(3-fluoroanilino)cyclohexyl]iminomethyl]-3-(4-fluorophenyl)iminopropanamide (PubChem CID 123292643) has the molecular formula C23H28F2N6O and a molecular weight of 442.51 g/mol. Its IUPAC name is 3-amino-2-[[1-(aminomethyl)-4-(3-fluoroanilino)cyclohexyl]iminomethyl]-3-(4-fluorophenyl)iminopropanamide.
| Compound Name | 3-amino-2-[[1-(aminomethyl)-4-(3-fluoroanilino)cyclohexyl]iminomethyl]-3-(4-fluorophenyl)iminopropanamide |
|---|---|
| PubChem CID | 123292643 |
| Molecular Formula | C23H28F2N6O |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | 3-amino-2-[[1-(aminomethyl)-4-(3-fluoroanilino)cyclohexyl]iminomethyl]-3-(4-fluorophenyl)iminopropanamide |
| SMILES | NCC1(/N=C/C(C(N)=O)/C(N)=N/c2ccc(F)cc2)CCC(Nc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C23H28F2N6O/c24-15-4-6-17(7-5-15)31-21(27)20(22(28)32)13-29-23(14-26)10-8-18(9-11-23)30-19-3-1-2-16(25)12-19/h1-7,12-13,18,20,30H,8-11,14,26H2,(H2,27,31)(H2,28,32)/b29-13+ |
| InChIKey | OABQOJNCDQZUBR-VFLNYLIXSA-N |
| XLogP | 2.88 |
| TPSA | 131.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|