C22H25IN2O4 — CID 130285949
tert-butyl N-[(Z)-1-(3-iodophenyl)-3-(4-methoxy-N-methylanilino)-3-oxoprop-1-en-2-yl]carbamate (PubChem CID 130285949) has the molecular formula C22H25IN2O4 and a molecular weight of 508.36 g/mol. Its IUPAC name is tert-butyl N-[(Z)-1-(3-iodophenyl)-3-(4-methoxy-N-methylanilino)-3-oxoprop-1-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(Z)-1-(3-iodophenyl)-3-(4-methoxy-N-methylanilino)-3-oxoprop-1-en-2-yl]carbamate |
|---|---|
| PubChem CID | 130285949 |
| Molecular Formula | C22H25IN2O4 |
| Molecular Weight | 508.36 g/mol |
| Exact Mass | 508.09 |
| IUPAC Name | tert-butyl N-[(Z)-1-(3-iodophenyl)-3-(4-methoxy-N-methylanilino)-3-oxoprop-1-en-2-yl]carbamate |
| SMILES | COc1ccc(N(C)C(=O)/C(=C/c2cccc(I)c2)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C22H25IN2O4/c1-22(2,3)29-21(27)24-19(14-15-7-6-8-16(23)13-15)20(26)25(4)17-9-11-18(28-5)12-10-17/h6-14H,1-5H3,(H,24,27)/b19-14- |
| InChIKey | WHXOGSBVBZCVAE-RGEXLXHISA-N |
| XLogP | 4.83 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.36 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|