About 5-[3-(1,1-difluoropropyl)phenyl]-3-methyl-1-phenylpyrazole
5-[3-(1,1-difluoropropyl)phenyl]-3-methyl-1-phenylpyrazole (PubChem CID 130286022) has the molecular formula C19H18F2N2
and a molecular weight of 312.36 g/mol. Its IUPAC name is 5-[3-(1,1-difluoropropyl)phenyl]-3-methyl-1-phenylpyrazole.
Molecular Properties
| Compound Name | 5-[3-(1,1-difluoropropyl)phenyl]-3-methyl-1-phenylpyrazole |
| PubChem CID | 130286022 |
| Molecular Formula | C19H18F2N2 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 5-[3-(1,1-difluoropropyl)phenyl]-3-methyl-1-phenylpyrazole |
| SMILES | CCC(F)(F)c1cccc(-c2cc(C)nn2-c2ccccc2)c1 |
| InChI | InChI=1S/C19H18F2N2/c1-3-19(20,21)16-9-7-8-15(13-16)18-12-14(2)22-23(18)17-10-5-4-6-11-17/h4-13H,3H2,1-2H3 |
| InChIKey | ZHWAKOFGMYJUJH-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[3-(1,1-difluoropropyl)phenyl]-3-methyl-1-phenylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-(1,1-difluoropropyl)phenyl]-3-methyl-1-phenylpyrazole?
The IUPAC name of 5-[3-(1,1-difluoropropyl)phenyl]-3-methyl-1-phenylpyrazole (CID 130286022) is 5-[3-(1,1-difluoropropyl)phenyl]-3-methyl-1-phenylpyrazole.
What is the SMILES notation for 5-[3-(1,1-difluoropropyl)phenyl]-3-methyl-1-phenylpyrazole?
The canonical SMILES for 5-[3-(1,1-difluoropropyl)phenyl]-3-methyl-1-phenylpyrazole is CCC(F)(F)c1cccc(-c2cc(C)nn2-c2ccccc2)c1.
What is the InChIKey of 5-[3-(1,1-difluoropropyl)phenyl]-3-methyl-1-phenylpyrazole?
The InChIKey is ZHWAKOFGMYJUJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18F2N2/c1-3-19(20,21)16-9-7-8-15(13-16)18-12-14(2)22-23(18)17-10-5-4-6-11-17/h4-13H,3H2,1-2H3.
What are the key properties of 5-[3-(1,1-difluoropropyl)phenyl]-3-methyl-1-phenylpyrazole?
5-[3-(1,1-difluoropropyl)phenyl]-3-methyl-1-phenylpyrazole has a molecular weight of 312.36 g/mol, XLogP of 5.35, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-(1,1-difluoropropyl)phenyl]-3-methyl-1-phenylpyrazole is sourced from PubChem (CID 130286022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).