C22H26F6N6O — CID 130286077
1-[(1S,2S,4S)-2-amino-4-[[(1R)-1-cyclopropyl-2,2,2-trifluoroethyl]amino]cyclohexyl]-3-[4-(trifluoromethyl)anilino]pyrazole-4-carboxamide (PubChem CID 130286077) has the molecular formula C22H26F6N6O and a molecular weight of 504.48 g/mol. Its IUPAC name is 1-[(1S,2S,4S)-2-amino-4-[[(1R)-1-cyclopropyl-2,2,2-trifluoroethyl]amino]cyclohexyl]-3-[4-(trifluoromethyl)anilino]pyrazole-4-carboxamide.
| Compound Name | 1-[(1S,2S,4S)-2-amino-4-[[(1R)-1-cyclopropyl-2,2,2-trifluoroethyl]amino]cyclohexyl]-3-[4-(trifluoromethyl)anilino]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 130286077 |
| Molecular Formula | C22H26F6N6O |
| Molecular Weight | 504.48 g/mol |
| Exact Mass | 504.21 |
| IUPAC Name | 1-[(1S,2S,4S)-2-amino-4-[[(1R)-1-cyclopropyl-2,2,2-trifluoroethyl]amino]cyclohexyl]-3-[4-(trifluoromethyl)anilino]pyrazole-4-carboxamide |
| SMILES | NC(=O)c1cn([C@H]2CC[C@H](N[C@H](C3CC3)C(F)(F)F)C[C@@H]2N)nc1Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H26F6N6O/c23-21(24,25)12-3-5-13(6-4-12)32-20-15(19(30)35)10-34(33-20)17-8-7-14(9-16(17)29)31-18(11-1-2-11)22(26,27)28/h3-6,10-11,14,16-18,31H,1-2,7-9,29H2,(H2,30,35)(H,32,33)/t14-,16-,17-,18+/m0/s1 |
| InChIKey | QNQHXYMUJGFBKW-LEUOFYLZSA-N |
| XLogP | 4.10 |
| TPSA | 110.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.48 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |