About 1-(2-nitrophenyl)propyl 3-[2-(2-ethoxyethoxy)ethoxy]propanoate
1-(2-nitrophenyl)propyl 3-[2-(2-ethoxyethoxy)ethoxy]propanoate (PubChem CID 130286400) has the molecular formula C18H27NO7
and a molecular weight of 369.41 g/mol. Its IUPAC name is 1-(2-nitrophenyl)propyl 3-[2-(2-ethoxyethoxy)ethoxy]propanoate.
Molecular Properties
| Compound Name | 1-(2-nitrophenyl)propyl 3-[2-(2-ethoxyethoxy)ethoxy]propanoate |
| PubChem CID | 130286400 |
| Molecular Formula | C18H27NO7 |
| Molecular Weight | 369.41 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | 1-(2-nitrophenyl)propyl 3-[2-(2-ethoxyethoxy)ethoxy]propanoate |
| SMILES | CCOCCOCCOCCC(=O)OC(CC)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H27NO7/c1-3-17(15-7-5-6-8-16(15)19(21)22)26-18(20)9-10-24-13-14-25-12-11-23-4-2/h5-8,17H,3-4,9-14H2,1-2H3 |
| InChIKey | KQVCRWHSGNURQI-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-nitrophenyl)propyl 3-[2-(2-ethoxyethoxy)ethoxy]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-nitrophenyl)propyl 3-[2-(2-ethoxyethoxy)ethoxy]propanoate?
The IUPAC name of 1-(2-nitrophenyl)propyl 3-[2-(2-ethoxyethoxy)ethoxy]propanoate (CID 130286400) is 1-(2-nitrophenyl)propyl 3-[2-(2-ethoxyethoxy)ethoxy]propanoate.
What is the SMILES notation for 1-(2-nitrophenyl)propyl 3-[2-(2-ethoxyethoxy)ethoxy]propanoate?
The canonical SMILES for 1-(2-nitrophenyl)propyl 3-[2-(2-ethoxyethoxy)ethoxy]propanoate is CCOCCOCCOCCC(=O)OC(CC)c1ccccc1[N+](=O)[O-].
What is the InChIKey of 1-(2-nitrophenyl)propyl 3-[2-(2-ethoxyethoxy)ethoxy]propanoate?
The InChIKey is KQVCRWHSGNURQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27NO7/c1-3-17(15-7-5-6-8-16(15)19(21)22)26-18(20)9-10-24-13-14-25-12-11-23-4-2/h5-8,17H,3-4,9-14H2,1-2H3.
What are the key properties of 1-(2-nitrophenyl)propyl 3-[2-(2-ethoxyethoxy)ethoxy]propanoate?
1-(2-nitrophenyl)propyl 3-[2-(2-ethoxyethoxy)ethoxy]propanoate has a molecular weight of 369.41 g/mol, XLogP of 3.05, 14 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-nitrophenyl)propyl 3-[2-(2-ethoxyethoxy)ethoxy]propanoate is sourced from PubChem (CID 130286400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).