C9H16FNO — CID 130291365
(3R)-1-fluoro-9-hydroxy-3-methyl-9-azabicyclo[3.3.1]nonane (PubChem CID 130291365) has the molecular formula C9H16FNO and a molecular weight of 173.23 g/mol. Its IUPAC name is (3R)-1-fluoro-9-hydroxy-3-methyl-9-azabicyclo[3.3.1]nonane.
| Compound Name | (3R)-1-fluoro-9-hydroxy-3-methyl-9-azabicyclo[3.3.1]nonane |
|---|---|
| PubChem CID | 130291365 |
| Molecular Formula | C9H16FNO |
| Molecular Weight | 173.23 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | (3R)-1-fluoro-9-hydroxy-3-methyl-9-azabicyclo[3.3.1]nonane |
| SMILES | C[C@@H]1CC2CCCC(F)(C1)N2O |
| InChI | InChI=1S/C9H16FNO/c1-7-5-8-3-2-4-9(10,6-7)11(8)12/h7-8,12H,2-6H2,1H3/t7-,8?,9?/m1/s1 |
| InChIKey | UBCOCGXWFPCWPP-AFPNSQJFSA-N |
| XLogP | 2.33 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.23 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|