C19H37N5O4 — CID 130293062
(4S)-5-[2-[[(2S)-3-(aziridin-1-yl)-2-(propan-2-ylamino)propanoyl]amino]ethylamino]-4-(butan-2-ylamino)-5-oxopentanoic acid (PubChem CID 130293062) has the molecular formula C19H37N5O4 and a molecular weight of 399.54 g/mol. Its IUPAC name is (4S)-5-[2-[[(2S)-3-(aziridin-1-yl)-2-(propan-2-ylamino)propanoyl]amino]ethylamino]-4-(butan-2-ylamino)-5-oxopentanoic acid.
| Compound Name | (4S)-5-[2-[[(2S)-3-(aziridin-1-yl)-2-(propan-2-ylamino)propanoyl]amino]ethylamino]-4-(butan-2-ylamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 130293062 |
| Molecular Formula | C19H37N5O4 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.28 |
| IUPAC Name | (4S)-5-[2-[[(2S)-3-(aziridin-1-yl)-2-(propan-2-ylamino)propanoyl]amino]ethylamino]-4-(butan-2-ylamino)-5-oxopentanoic acid |
| SMILES | CCC(C)N[C@@H](CCC(=O)O)C(=O)NCCNC(=O)[C@H](CN1CC1)NC(C)C |
| InChI | InChI=1S/C19H37N5O4/c1-5-14(4)23-15(6-7-17(25)26)18(27)20-8-9-21-19(28)16(22-13(2)3)12-24-10-11-24/h13-16,22-23H,5-12H2,1-4H3,(H,20,27)(H,21,28)(H,25,26)/t14?,15-,16-/m0/s1 |
| InChIKey | JRMGYZMYNQZSEQ-YVZMLIKISA-N |
| XLogP | -0.48 |
| TPSA | 122.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|