C20H39N5O4 — CID 166736961
(4S)-5-[2-[[(2S)-3-(aziridin-1-yl)-2-(tert-butylamino)propanoyl]amino]ethylamino]-4-(butan-2-ylamino)-5-oxopentanoic acid (PubChem CID 166736961) has the molecular formula C20H39N5O4 and a molecular weight of 413.56 g/mol. Its IUPAC name is (4S)-5-[2-[[(2S)-3-(aziridin-1-yl)-2-(tert-butylamino)propanoyl]amino]ethylamino]-4-(butan-2-ylamino)-5-oxopentanoic acid.
| Compound Name | (4S)-5-[2-[[(2S)-3-(aziridin-1-yl)-2-(tert-butylamino)propanoyl]amino]ethylamino]-4-(butan-2-ylamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 166736961 |
| Molecular Formula | C20H39N5O4 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.30 |
| IUPAC Name | (4S)-5-[2-[[(2S)-3-(aziridin-1-yl)-2-(tert-butylamino)propanoyl]amino]ethylamino]-4-(butan-2-ylamino)-5-oxopentanoic acid |
| SMILES | CCC(C)N[C@@H](CCC(=O)O)C(=O)NCCNC(=O)[C@H](CN1CC1)NC(C)(C)C |
| InChI | InChI=1S/C20H39N5O4/c1-6-14(2)23-15(7-8-17(26)27)18(28)21-9-10-22-19(29)16(13-25-11-12-25)24-20(3,4)5/h14-16,23-24H,6-13H2,1-5H3,(H,21,28)(H,22,29)(H,26,27)/t14?,15-,16-/m0/s1 |
| InChIKey | VJBXNYTVMDUPPH-YVZMLIKISA-N |
| XLogP | -0.09 |
| TPSA | 122.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|