C19H25N3O — CID 130293873
N-methyl-1-[1-[(2E,4Z)-2-methylhexa-2,4-dienyl]-5-phenylmethoxypyrazol-3-yl]methanamine (PubChem CID 130293873) has the molecular formula C19H25N3O and a molecular weight of 311.43 g/mol. Its IUPAC name is N-methyl-1-[1-[(2E,4Z)-2-methylhexa-2,4-dienyl]-5-phenylmethoxypyrazol-3-yl]methanamine.
| Compound Name | N-methyl-1-[1-[(2E,4Z)-2-methylhexa-2,4-dienyl]-5-phenylmethoxypyrazol-3-yl]methanamine |
|---|---|
| PubChem CID | 130293873 |
| Molecular Formula | C19H25N3O |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | N-methyl-1-[1-[(2E,4Z)-2-methylhexa-2,4-dienyl]-5-phenylmethoxypyrazol-3-yl]methanamine |
| SMILES | C/C=C\C=C(/C)Cn1nc(CNC)cc1OCc1ccccc1 |
| InChI | InChI=1S/C19H25N3O/c1-4-5-9-16(2)14-22-19(12-18(21-22)13-20-3)23-15-17-10-7-6-8-11-17/h4-12,20H,13-15H2,1-3H3/b5-4-,16-9+ |
| InChIKey | NVMDGOWKLLXEGN-MEDLKETBSA-N |
| XLogP | 3.70 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|