C18H28ClN3O — CID 66665001
1-[1-(2-ethylbutyl)-5-phenylmethoxypyrazol-3-yl]-N-methylmethanamine;hydrochloride (PubChem CID 66665001) has the molecular formula C18H28ClN3O and a molecular weight of 337.90 g/mol. Its IUPAC name is 1-[1-(2-ethylbutyl)-5-phenylmethoxypyrazol-3-yl]-N-methylmethanamine;hydrochloride.
| Compound Name | 1-[1-(2-ethylbutyl)-5-phenylmethoxypyrazol-3-yl]-N-methylmethanamine;hydrochloride |
|---|---|
| PubChem CID | 66665001 |
| Molecular Formula | C18H28ClN3O |
| Molecular Weight | 337.90 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | 1-[1-(2-ethylbutyl)-5-phenylmethoxypyrazol-3-yl]-N-methylmethanamine;hydrochloride |
| SMILES | CCC(CC)Cn1nc(CNC)cc1OCc1ccccc1.Cl |
| InChI | InChI=1S/C18H27N3O.ClH/c1-4-15(5-2)13-21-18(11-17(20-21)12-19-3)22-14-16-9-7-6-8-10-16;/h6-11,15,19H,4-5,12-14H2,1-3H3;1H |
| InChIKey | QBLQLEJHFUAQGL-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.90 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |