C26H23FN4O2 — CID 130294657
1-[4-[7-(2-fluoro-4-phenoxyphenyl)-1H-pyrazolo[3,4-c]pyridin-5-yl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 130294657) has the molecular formula C26H23FN4O2 and a molecular weight of 442.49 g/mol. Its IUPAC name is 1-[4-[7-(2-fluoro-4-phenoxyphenyl)-1H-pyrazolo[3,4-c]pyridin-5-yl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[7-(2-fluoro-4-phenoxyphenyl)-1H-pyrazolo[3,4-c]pyridin-5-yl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 130294657 |
| Molecular Formula | C26H23FN4O2 |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | 1-[4-[7-(2-fluoro-4-phenoxyphenyl)-1H-pyrazolo[3,4-c]pyridin-5-yl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(c2cc3cn[nH]c3c(-c3ccc(Oc4ccccc4)cc3F)n2)CC1 |
| InChI | InChI=1S/C26H23FN4O2/c1-2-24(32)31-12-10-17(11-13-31)23-14-18-16-28-30-25(18)26(29-23)21-9-8-20(15-22(21)27)33-19-6-4-3-5-7-19/h2-9,14-17H,1,10-13H2,(H,28,30) |
| InChIKey | PPMFVPFDCXMETK-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|