C25H24N4O2 — CID 130294679
1-[3-[5-amino-4-methanimidoyl-6-(4-phenoxyphenyl)-2-pyridinyl]pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 130294679) has the molecular formula C25H24N4O2 and a molecular weight of 412.49 g/mol. Its IUPAC name is 1-[3-[5-amino-4-methanimidoyl-6-(4-phenoxyphenyl)-2-pyridinyl]pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[5-amino-4-methanimidoyl-6-(4-phenoxyphenyl)-2-pyridinyl]pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 130294679 |
| Molecular Formula | C25H24N4O2 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | 1-[3-[5-amino-4-methanimidoyl-6-(4-phenoxyphenyl)-2-pyridinyl]pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | [H]/N=C/c1cc(C2CCN(C(=O)C=C)C2)nc(-c2ccc(Oc3ccccc3)cc2)c1N |
| InChI | InChI=1S/C25H24N4O2/c1-2-23(30)29-13-12-18(16-29)22-14-19(15-26)24(27)25(28-22)17-8-10-21(11-9-17)31-20-6-4-3-5-7-20/h2-11,14-15,18,26H,1,12-13,16,27H2/b26-15+ |
| InChIKey | SNYVIMLIEOTANZ-CVKSISIWSA-N |
| XLogP | 4.62 |
| TPSA | 92.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|