C24H30N4O — CID 130295621
1-[3-[[3-(3-azatricyclo[3.1.0.02,6]hex-1(6)-en-3-yl)propylamino]methyl]-7-methylquinolin-2-yl]piperidin-4-ol (PubChem CID 130295621) has the molecular formula C24H30N4O and a molecular weight of 390.53 g/mol. Its IUPAC name is 1-[3-[[3-(3-azatricyclo[3.1.0.02,6]hex-1(6)-en-3-yl)propylamino]methyl]-7-methylquinolin-2-yl]piperidin-4-ol.
| Compound Name | 1-[3-[[3-(3-azatricyclo[3.1.0.02,6]hex-1(6)-en-3-yl)propylamino]methyl]-7-methylquinolin-2-yl]piperidin-4-ol |
|---|---|
| PubChem CID | 130295621 |
| Molecular Formula | C24H30N4O |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | 1-[3-[[3-(3-azatricyclo[3.1.0.02,6]hex-1(6)-en-3-yl)propylamino]methyl]-7-methylquinolin-2-yl]piperidin-4-ol |
| SMILES | Cc1ccc2cc(CNCCCN3CC4C5=C4C53)c(N3CCC(O)CC3)nc2c1 |
| InChI | InChI=1S/C24H30N4O/c1-15-3-4-16-12-17(13-25-7-2-8-28-14-19-21-22(19)23(21)28)24(26-20(16)11-15)27-9-5-18(29)6-10-27/h3-4,11-12,18-19,23,25,29H,2,5-10,13-14H2,1H3 |
| InChIKey | FVXMEDRRKULCGK-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 51.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|