C21H29N3O2 — CID 175642375
(3aR,5R,6R,7aS)-6-(dimethylamino)-2-[3-(hydroxymethyl)-7-methylquinolin-2-yl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol (PubChem CID 175642375) has the molecular formula C21H29N3O2 and a molecular weight of 355.48 g/mol. Its IUPAC name is (3aR,5R,6R,7aS)-6-(dimethylamino)-2-[3-(hydroxymethyl)-7-methylquinolin-2-yl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol.
| Compound Name | (3aR,5R,6R,7aS)-6-(dimethylamino)-2-[3-(hydroxymethyl)-7-methylquinolin-2-yl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
|---|---|
| PubChem CID | 175642375 |
| Molecular Formula | C21H29N3O2 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | (3aR,5R,6R,7aS)-6-(dimethylamino)-2-[3-(hydroxymethyl)-7-methylquinolin-2-yl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
| SMILES | Cc1ccc2cc(CO)c(N3C[C@H]4C[C@@H](N(C)C)[C@H](O)C[C@H]4C3)nc2c1 |
| InChI | InChI=1S/C21H29N3O2/c1-13-4-5-14-7-17(12-25)21(22-18(14)6-13)24-10-15-8-19(23(2)3)20(26)9-16(15)11-24/h4-7,15-16,19-20,25-26H,8-12H2,1-3H3/t15-,16+,19-,20-/m1/s1 |
| InChIKey | AOUMIXCZGXSISZ-WOUAJJJCSA-N |
| XLogP | 2.17 |
| TPSA | 59.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |