C17H21ClN2O — CID 60661917
[1-[(2-chloro-7-methylquinolin-3-yl)methyl]piperidin-3-yl]methanol (PubChem CID 60661917) has the molecular formula C17H21ClN2O and a molecular weight of 304.82 g/mol. Its IUPAC name is [1-[(2-chloro-7-methylquinolin-3-yl)methyl]piperidin-3-yl]methanol.
| Compound Name | [1-[(2-chloro-7-methylquinolin-3-yl)methyl]piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 60661917 |
| Molecular Formula | C17H21ClN2O |
| Molecular Weight | 304.82 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | [1-[(2-chloro-7-methylquinolin-3-yl)methyl]piperidin-3-yl]methanol |
| SMILES | Cc1ccc2cc(CN3CCCC(CO)C3)c(Cl)nc2c1 |
| InChI | InChI=1S/C17H21ClN2O/c1-12-4-5-14-8-15(17(18)19-16(14)7-12)10-20-6-2-3-13(9-20)11-21/h4-5,7-8,13,21H,2-3,6,9-11H2,1H3 |
| InChIKey | OBXDCYOETYACOV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.82 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|