C20H25NOS — CID 50852233
[1-[[2-(3-methylphenyl)sulfanylphenyl]methyl]piperidin-3-yl]methanol (PubChem CID 50852233) has the molecular formula C20H25NOS and a molecular weight of 327.49 g/mol. Its IUPAC name is [1-[[2-(3-methylphenyl)sulfanylphenyl]methyl]piperidin-3-yl]methanol.
| Compound Name | [1-[[2-(3-methylphenyl)sulfanylphenyl]methyl]piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 50852233 |
| Molecular Formula | C20H25NOS |
| Molecular Weight | 327.49 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | [1-[[2-(3-methylphenyl)sulfanylphenyl]methyl]piperidin-3-yl]methanol |
| SMILES | Cc1cccc(Sc2ccccc2CN2CCCC(CO)C2)c1 |
| InChI | InChI=1S/C20H25NOS/c1-16-6-4-9-19(12-16)23-20-10-3-2-8-18(20)14-21-11-5-7-17(13-21)15-22/h2-4,6,8-10,12,17,22H,5,7,11,13-15H2,1H3 |
| InChIKey | VFOUDCVQXHQWJU-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.49 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |