C20H24ClN3O2 — CID 51923514
[4-[(2-chloro-7-methylquinolin-3-yl)methyl]piperazin-1-yl]-[(2R)-oxolan-2-yl]methanone (PubChem CID 51923514) has the molecular formula C20H24ClN3O2 and a molecular weight of 373.88 g/mol. Its IUPAC name is [4-[(2-chloro-7-methylquinolin-3-yl)methyl]piperazin-1-yl]-[(2R)-oxolan-2-yl]methanone.
| Compound Name | [4-[(2-chloro-7-methylquinolin-3-yl)methyl]piperazin-1-yl]-[(2R)-oxolan-2-yl]methanone |
|---|---|
| PubChem CID | 51923514 |
| Molecular Formula | C20H24ClN3O2 |
| Molecular Weight | 373.88 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | [4-[(2-chloro-7-methylquinolin-3-yl)methyl]piperazin-1-yl]-[(2R)-oxolan-2-yl]methanone |
| SMILES | Cc1ccc2cc(CN3CCN(C(=O)[C@H]4CCCO4)CC3)c(Cl)nc2c1 |
| InChI | InChI=1S/C20H24ClN3O2/c1-14-4-5-15-12-16(19(21)22-17(15)11-14)13-23-6-8-24(9-7-23)20(25)18-3-2-10-26-18/h4-5,11-12,18H,2-3,6-10,13H2,1H3/t18-/m1/s1 |
| InChIKey | RRPQOIGKEWTXFX-GOSISDBHSA-N |
| XLogP | 3.02 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.88 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|