C22H19FN6O3 — CID 130298917
1-[(3-cyanophenyl)methyl]-N-[(2R,3S)-2,5-dimethyl-4-oxo-2,3-dihydropyrido[3,2-b][1,4]oxazepin-3-yl]-4-fluoropyrazole-3-carboxamide (PubChem CID 130298917) has the molecular formula C22H19FN6O3 and a molecular weight of 434.43 g/mol. Its IUPAC name is 1-[(3-cyanophenyl)methyl]-N-[(2R,3S)-2,5-dimethyl-4-oxo-2,3-dihydropyrido[3,2-b][1,4]oxazepin-3-yl]-4-fluoropyrazole-3-carboxamide.
| Compound Name | 1-[(3-cyanophenyl)methyl]-N-[(2R,3S)-2,5-dimethyl-4-oxo-2,3-dihydropyrido[3,2-b][1,4]oxazepin-3-yl]-4-fluoropyrazole-3-carboxamide |
|---|---|
| PubChem CID | 130298917 |
| Molecular Formula | C22H19FN6O3 |
| Molecular Weight | 434.43 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | 1-[(3-cyanophenyl)methyl]-N-[(2R,3S)-2,5-dimethyl-4-oxo-2,3-dihydropyrido[3,2-b][1,4]oxazepin-3-yl]-4-fluoropyrazole-3-carboxamide |
| SMILES | C[C@H]1Oc2cccnc2N(C)C(=O)[C@H]1NC(=O)c1nn(Cc2cccc(C#N)c2)cc1F |
| InChI | InChI=1S/C22H19FN6O3/c1-13-18(22(31)28(2)20-17(32-13)7-4-8-25-20)26-21(30)19-16(23)12-29(27-19)11-15-6-3-5-14(9-15)10-24/h3-9,12-13,18H,11H2,1-2H3,(H,26,30)/t13-,18+/m1/s1 |
| InChIKey | RQMZNTKYKTZBKH-ACJLOTCBSA-N |
| XLogP | 1.88 |
| TPSA | 113.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.43 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |