C21H19F2N5O3 — CID 130299200
N-[(2R,3S)-2,5-dimethyl-4-oxo-2,3-dihydropyrido[3,2-b][1,4]oxazepin-3-yl]-4-fluoro-1-[(4-fluorophenyl)methyl]pyrazole-3-carboxamide (PubChem CID 130299200) has the molecular formula C21H19F2N5O3 and a molecular weight of 427.41 g/mol. Its IUPAC name is N-[(2R,3S)-2,5-dimethyl-4-oxo-2,3-dihydropyrido[3,2-b][1,4]oxazepin-3-yl]-4-fluoro-1-[(4-fluorophenyl)methyl]pyrazole-3-carboxamide.
| Compound Name | N-[(2R,3S)-2,5-dimethyl-4-oxo-2,3-dihydropyrido[3,2-b][1,4]oxazepin-3-yl]-4-fluoro-1-[(4-fluorophenyl)methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 130299200 |
| Molecular Formula | C21H19F2N5O3 |
| Molecular Weight | 427.41 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | N-[(2R,3S)-2,5-dimethyl-4-oxo-2,3-dihydropyrido[3,2-b][1,4]oxazepin-3-yl]-4-fluoro-1-[(4-fluorophenyl)methyl]pyrazole-3-carboxamide |
| SMILES | C[C@H]1Oc2cccnc2N(C)C(=O)[C@H]1NC(=O)c1nn(Cc2ccc(F)cc2)cc1F |
| InChI | InChI=1S/C21H19F2N5O3/c1-12-17(21(30)27(2)19-16(31-12)4-3-9-24-19)25-20(29)18-15(23)11-28(26-18)10-13-5-7-14(22)8-6-13/h3-9,11-12,17H,10H2,1-2H3,(H,25,29)/t12-,17+/m1/s1 |
| InChIKey | SYEUIBJXMVFFDV-PXAZEXFGSA-N |
| XLogP | 2.15 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.41 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |