C18H30NO5P — CID 130300922
(2S)-2-[[methoxymethyl-(5-methyl-2-propan-2-ylphenoxy)phosphoryl]amino]-2,3-dimethylbutanoic acid (PubChem CID 130300922) has the molecular formula C18H30NO5P and a molecular weight of 371.41 g/mol. Its IUPAC name is (2S)-2-[[methoxymethyl-(5-methyl-2-propan-2-ylphenoxy)phosphoryl]amino]-2,3-dimethylbutanoic acid.
| Compound Name | (2S)-2-[[methoxymethyl-(5-methyl-2-propan-2-ylphenoxy)phosphoryl]amino]-2,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 130300922 |
| Molecular Formula | C18H30NO5P |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | (2S)-2-[[methoxymethyl-(5-methyl-2-propan-2-ylphenoxy)phosphoryl]amino]-2,3-dimethylbutanoic acid |
| SMILES | COCP(=O)(N[C@](C)(C(=O)O)C(C)C)Oc1cc(C)ccc1C(C)C |
| InChI | InChI=1S/C18H30NO5P/c1-12(2)15-9-8-14(5)10-16(15)24-25(22,11-23-7)19-18(6,13(3)4)17(20)21/h8-10,12-13H,11H2,1-7H3,(H,19,22)(H,20,21)/t18-,25?/m0/s1 |
| InChIKey | ZWCUHNYCRXWJGF-CPFIQGLUSA-N |
| XLogP | 4.38 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|