C23H20F4N8O4 — CID 130301695
(2S,4R)-4-(azidomethyl)-1-N-(1-carbamoylindol-3-yl)-4-fluoro-2-N-[3-(trifluoromethoxy)phenyl]pyrrolidine-1,2-dicarboxamide (PubChem CID 130301695) has the molecular formula C23H20F4N8O4 and a molecular weight of 548.46 g/mol. Its IUPAC name is (2S,4R)-4-(azidomethyl)-1-N-(1-carbamoylindol-3-yl)-4-fluoro-2-N-[3-(trifluoromethoxy)phenyl]pyrrolidine-1,2-dicarboxamide.
| Compound Name | (2S,4R)-4-(azidomethyl)-1-N-(1-carbamoylindol-3-yl)-4-fluoro-2-N-[3-(trifluoromethoxy)phenyl]pyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 130301695 |
| Molecular Formula | C23H20F4N8O4 |
| Molecular Weight | 548.46 g/mol |
| Exact Mass | 548.15 |
| IUPAC Name | (2S,4R)-4-(azidomethyl)-1-N-(1-carbamoylindol-3-yl)-4-fluoro-2-N-[3-(trifluoromethoxy)phenyl]pyrrolidine-1,2-dicarboxamide |
| SMILES | [N-]=[N+]=NC[C@@]1(F)C[C@@H](C(=O)Nc2cccc(OC(F)(F)F)c2)N(C(=O)Nc2cn(C(N)=O)c3ccccc23)C1 |
| InChI | InChI=1S/C23H20F4N8O4/c24-22(11-30-33-29)9-18(19(36)31-13-4-3-5-14(8-13)39-23(25,26)27)35(12-22)21(38)32-16-10-34(20(28)37)17-7-2-1-6-15(16)17/h1-8,10,18H,9,11-12H2,(H2,28,37)(H,31,36)(H,32,38)/t18-,22-/m0/s1 |
| InChIKey | WGGKIYXZRBWYMM-AVRDEDQJSA-N |
| XLogP | 4.73 |
| TPSA | 167.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.46 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|