C11H11F2N3O2 — CID 130302323
[1-[3-(difluoromethoxy)-4-methylphenyl]triazol-4-yl]methanol (PubChem CID 130302323) has the molecular formula C11H11F2N3O2 and a molecular weight of 255.22 g/mol. Its IUPAC name is [1-[3-(difluoromethoxy)-4-methylphenyl]triazol-4-yl]methanol.
| Compound Name | [1-[3-(difluoromethoxy)-4-methylphenyl]triazol-4-yl]methanol |
|---|---|
| PubChem CID | 130302323 |
| Molecular Formula | C11H11F2N3O2 |
| Molecular Weight | 255.22 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | [1-[3-(difluoromethoxy)-4-methylphenyl]triazol-4-yl]methanol |
| SMILES | Cc1ccc(-n2cc(CO)nn2)cc1OC(F)F |
| InChI | InChI=1S/C11H11F2N3O2/c1-7-2-3-9(4-10(7)18-11(12)13)16-5-8(6-17)14-15-16/h2-5,11,17H,6H2,1H3 |
| InChIKey | URYHCKNOLFCBEO-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.22 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |