C16H18ClF2N5O2 — CID 145351429
(1E,3Z)-1-[[1-[4-chloro-3-(difluoromethoxy)phenyl]triazol-4-yl]methoxy]-3-methylpenta-1,3-diene-1,4-diamine (PubChem CID 145351429) has the molecular formula C16H18ClF2N5O2 and a molecular weight of 385.80 g/mol. Its IUPAC name is (1E,3Z)-1-[[1-[4-chloro-3-(difluoromethoxy)phenyl]triazol-4-yl]methoxy]-3-methylpenta-1,3-diene-1,4-diamine.
| Compound Name | (1E,3Z)-1-[[1-[4-chloro-3-(difluoromethoxy)phenyl]triazol-4-yl]methoxy]-3-methylpenta-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 145351429 |
| Molecular Formula | C16H18ClF2N5O2 |
| Molecular Weight | 385.80 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | (1E,3Z)-1-[[1-[4-chloro-3-(difluoromethoxy)phenyl]triazol-4-yl]methoxy]-3-methylpenta-1,3-diene-1,4-diamine |
| SMILES | C/C(N)=C(C)/C=C(\N)OCc1cn(-c2ccc(Cl)c(OC(F)F)c2)nn1 |
| InChI | InChI=1S/C16H18ClF2N5O2/c1-9(10(2)20)5-15(21)25-8-11-7-24(23-22-11)12-3-4-13(17)14(6-12)26-16(18)19/h3-7,16H,8,20-21H2,1-2H3/b10-9-,15-5+ |
| InChIKey | AWHVDBZCLSPRPX-TWLWBBMBSA-N |
| XLogP | 3.09 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.80 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|