C12H20BrN3O2S — CID 130302524
5-bromo-N-(3,3-diethoxypropyl)-2-methylsulfanylpyrimidin-4-amine (PubChem CID 130302524) has the molecular formula C12H20BrN3O2S and a molecular weight of 350.28 g/mol. Its IUPAC name is 5-bromo-N-(3,3-diethoxypropyl)-2-methylsulfanylpyrimidin-4-amine.
| Compound Name | 5-bromo-N-(3,3-diethoxypropyl)-2-methylsulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 130302524 |
| Molecular Formula | C12H20BrN3O2S |
| Molecular Weight | 350.28 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | 5-bromo-N-(3,3-diethoxypropyl)-2-methylsulfanylpyrimidin-4-amine |
| SMILES | CCOC(CCNc1nc(SC)ncc1Br)OCC |
| InChI | InChI=1S/C12H20BrN3O2S/c1-4-17-10(18-5-2)6-7-14-11-9(13)8-15-12(16-11)19-3/h8,10H,4-7H2,1-3H3,(H,14,15,16) |
| InChIKey | HWMWCWIHQXPZDX-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.28 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|