C14H19ClN2O2 — CID 130303023
4-[4-(2-aminoethyl)-2-chlorophenyl]piperidine-1-carboxylic acid (PubChem CID 130303023) has the molecular formula C14H19ClN2O2 and a molecular weight of 282.77 g/mol. Its IUPAC name is 4-[4-(2-aminoethyl)-2-chlorophenyl]piperidine-1-carboxylic acid.
| Compound Name | 4-[4-(2-aminoethyl)-2-chlorophenyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 130303023 |
| Molecular Formula | C14H19ClN2O2 |
| Molecular Weight | 282.77 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 4-[4-(2-aminoethyl)-2-chlorophenyl]piperidine-1-carboxylic acid |
| SMILES | NCCc1ccc(C2CCN(C(=O)O)CC2)c(Cl)c1 |
| InChI | InChI=1S/C14H19ClN2O2/c15-13-9-10(3-6-16)1-2-12(13)11-4-7-17(8-5-11)14(18)19/h1-2,9,11H,3-8,16H2,(H,18,19) |
| InChIKey | ZBYAYEZCEYCCTA-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.77 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |