C21H19ClN2O4 — CID 141303529
4-[2-chloro-5-[(1,3-dioxoisoindol-2-yl)methyl]phenyl]piperidine-1-carboxylic acid (PubChem CID 141303529) has the molecular formula C21H19ClN2O4 and a molecular weight of 398.85 g/mol. Its IUPAC name is 4-[2-chloro-5-[(1,3-dioxoisoindol-2-yl)methyl]phenyl]piperidine-1-carboxylic acid.
| Compound Name | 4-[2-chloro-5-[(1,3-dioxoisoindol-2-yl)methyl]phenyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 141303529 |
| Molecular Formula | C21H19ClN2O4 |
| Molecular Weight | 398.85 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 4-[2-chloro-5-[(1,3-dioxoisoindol-2-yl)methyl]phenyl]piperidine-1-carboxylic acid |
| SMILES | O=C(O)N1CCC(c2cc(CN3C(=O)c4ccccc4C3=O)ccc2Cl)CC1 |
| InChI | InChI=1S/C21H19ClN2O4/c22-18-6-5-13(11-17(18)14-7-9-23(10-8-14)21(27)28)12-24-19(25)15-3-1-2-4-16(15)20(24)26/h1-6,11,14H,7-10,12H2,(H,27,28) |
| InChIKey | PEWABTGIKRBXHG-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.85 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|