C9H6F2N2O2 — CID 130303543
7-(difluoromethoxy)-1H-1,5-naphthyridin-2-one (PubChem CID 130303543) has the molecular formula C9H6F2N2O2 and a molecular weight of 212.16 g/mol. Its IUPAC name is 7-(difluoromethoxy)-1H-1,5-naphthyridin-2-one.
| Compound Name | 7-(difluoromethoxy)-1H-1,5-naphthyridin-2-one |
|---|---|
| PubChem CID | 130303543 |
| Molecular Formula | C9H6F2N2O2 |
| Molecular Weight | 212.16 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | 7-(difluoromethoxy)-1H-1,5-naphthyridin-2-one |
| SMILES | O=c1ccc2ncc(OC(F)F)cc2[nH]1 |
| InChI | InChI=1S/C9H6F2N2O2/c10-9(11)15-5-3-7-6(12-4-5)1-2-8(14)13-7/h1-4,9H,(H,13,14) |
| InChIKey | PGBAUIVMSXYNNF-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.16 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |