C42H48N2O2 — CID 130304854
2,5-dihexyl-1-methyl-4-[4-[(E)-2-[4-[(E)-2-(4-methylphenyl)ethenyl]phenyl]ethenyl]phenyl]pyrrolo[3,4-c]pyrrole-3,6-dione (PubChem CID 130304854) has the molecular formula C42H48N2O2 and a molecular weight of 612.86 g/mol. Its IUPAC name is 2,5-dihexyl-1-methyl-4-[4-[(E)-2-[4-[(E)-2-(4-methylphenyl)ethenyl]phenyl]ethenyl]phenyl]pyrrolo[3,4-c]pyrrole-3,6-dione.
| Compound Name | 2,5-dihexyl-1-methyl-4-[4-[(E)-2-[4-[(E)-2-(4-methylphenyl)ethenyl]phenyl]ethenyl]phenyl]pyrrolo[3,4-c]pyrrole-3,6-dione |
|---|---|
| PubChem CID | 130304854 |
| Molecular Formula | C42H48N2O2 |
| Molecular Weight | 612.86 g/mol |
| Exact Mass | 612.37 |
| IUPAC Name | 2,5-dihexyl-1-methyl-4-[4-[(E)-2-[4-[(E)-2-(4-methylphenyl)ethenyl]phenyl]ethenyl]phenyl]pyrrolo[3,4-c]pyrrole-3,6-dione |
| SMILES | CCCCCCN1C(=O)C2=C(c3ccc(/C=C/c4ccc(/C=C/c5ccc(C)cc5)cc4)cc3)N(CCCCCC)C(=O)C2=C1C |
| InChI | InChI=1S/C42H48N2O2/c1-5-7-9-11-29-43-32(4)38-39(42(43)46)40(44(41(38)45)30-12-10-8-6-2)37-27-25-36(26-28-37)24-23-35-21-19-34(20-22-35)18-17-33-15-13-31(3)14-16-33/h13-28H,5-12,29-30H2,1-4H3/b18-17+,24-23+ |
| InChIKey | OPUBNKIDIMAUQF-QZOSNYCWSA-N |
| XLogP | 10.17 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.86 |
| LogP ≤ 5 | 10.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|