C20H20ClFN2O4 — CID 130304866
N-[(3-chloro-5-fluorophenyl)methyl]-3-hydroxy-1-(2-hydroxy-1-phenylethyl)-2-oxopyrrolidine-3-carboxamide (PubChem CID 130304866) has the molecular formula C20H20ClFN2O4 and a molecular weight of 406.84 g/mol. Its IUPAC name is N-[(3-chloro-5-fluorophenyl)methyl]-3-hydroxy-1-(2-hydroxy-1-phenylethyl)-2-oxopyrrolidine-3-carboxamide.
| Compound Name | N-[(3-chloro-5-fluorophenyl)methyl]-3-hydroxy-1-(2-hydroxy-1-phenylethyl)-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 130304866 |
| Molecular Formula | C20H20ClFN2O4 |
| Molecular Weight | 406.84 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | N-[(3-chloro-5-fluorophenyl)methyl]-3-hydroxy-1-(2-hydroxy-1-phenylethyl)-2-oxopyrrolidine-3-carboxamide |
| SMILES | O=C(NCc1cc(F)cc(Cl)c1)C1(O)CCN(C(CO)c2ccccc2)C1=O |
| InChI | InChI=1S/C20H20ClFN2O4/c21-15-8-13(9-16(22)10-15)11-23-18(26)20(28)6-7-24(19(20)27)17(12-25)14-4-2-1-3-5-14/h1-5,8-10,17,25,28H,6-7,11-12H2,(H,23,26) |
| InChIKey | RHFGHLCLDFNYFL-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.84 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|