C13H14ClFN2O3 — CID 56960952
(3S)-N-[(3-chloro-5-fluorophenyl)methyl]-3-hydroxy-1-methyl-2-oxopyrrolidine-3-carboxamide (PubChem CID 56960952) has the molecular formula C13H14ClFN2O3 and a molecular weight of 300.72 g/mol. Its IUPAC name is (3S)-N-[(3-chloro-5-fluorophenyl)methyl]-3-hydroxy-1-methyl-2-oxopyrrolidine-3-carboxamide.
| Compound Name | (3S)-N-[(3-chloro-5-fluorophenyl)methyl]-3-hydroxy-1-methyl-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 56960952 |
| Molecular Formula | C13H14ClFN2O3 |
| Molecular Weight | 300.72 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | (3S)-N-[(3-chloro-5-fluorophenyl)methyl]-3-hydroxy-1-methyl-2-oxopyrrolidine-3-carboxamide |
| SMILES | CN1CC[C@](O)(C(=O)NCc2cc(F)cc(Cl)c2)C1=O |
| InChI | InChI=1S/C13H14ClFN2O3/c1-17-3-2-13(20,12(17)19)11(18)16-7-8-4-9(14)6-10(15)5-8/h4-6,20H,2-3,7H2,1H3,(H,16,18)/t13-/m0/s1 |
| InChIKey | ZXCLMJIJBABXKB-ZDUSSCGKSA-N |
| XLogP | 0.69 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.72 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|