C13H19FN4 — CID 130306321
1-[(2R,6S)-2,6-dimethylpiperidine-1-carboximidoyl]-5-fluoropyridin-2-imine (PubChem CID 130306321) has the molecular formula C13H19FN4 and a molecular weight of 250.32 g/mol. Its IUPAC name is 1-[(2R,6S)-2,6-dimethylpiperidine-1-carboximidoyl]-5-fluoropyridin-2-imine.
| Compound Name | 1-[(2R,6S)-2,6-dimethylpiperidine-1-carboximidoyl]-5-fluoropyridin-2-imine |
|---|---|
| PubChem CID | 130306321 |
| Molecular Formula | C13H19FN4 |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 1-[(2R,6S)-2,6-dimethylpiperidine-1-carboximidoyl]-5-fluoropyridin-2-imine |
| SMILES | [H]/N=C(\N1[C@H](C)CCC[C@@H]1C)n1cc(F)cc/c1=N\[H] |
| InChI | InChI=1S/C13H19FN4/c1-9-4-3-5-10(2)18(9)13(16)17-8-11(14)6-7-12(17)15/h6-10,15-16H,3-5H2,1-2H3/b15-12+,16-13-/t9-,10+ |
| InChIKey | LCBSTHJYXNMDDW-VKACSAMSSA-N |
| XLogP | 2.15 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|