C12H19FN4 — CID 123830971
5-fluoro-2-imino-N,N-di(propan-2-yl)pyridine-1-carboximidamide (PubChem CID 123830971) has the molecular formula C12H19FN4 and a molecular weight of 238.31 g/mol. Its IUPAC name is 5-fluoro-2-imino-N,N-di(propan-2-yl)pyridine-1-carboximidamide.
| Compound Name | 5-fluoro-2-imino-N,N-di(propan-2-yl)pyridine-1-carboximidamide |
|---|---|
| PubChem CID | 123830971 |
| Molecular Formula | C12H19FN4 |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | 5-fluoro-2-imino-N,N-di(propan-2-yl)pyridine-1-carboximidamide |
| SMILES | [H]/N=C(\N(C(C)C)C(C)C)n1cc(F)cc/c1=N\[H] |
| InChI | InChI=1S/C12H19FN4/c1-8(2)17(9(3)4)12(15)16-7-10(13)5-6-11(16)14/h5-9,14-15H,1-4H3/b14-11+,15-12- |
| InChIKey | JDMBNGLBOGREST-ADBGAXBCSA-N |
| XLogP | 2.01 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|