C10H15FN4 — CID 123619854
5-fluoro-2-imino-N-methyl-N-propylpyridine-1-carboximidamide (PubChem CID 123619854) has the molecular formula C10H15FN4 and a molecular weight of 210.26 g/mol. Its IUPAC name is 5-fluoro-2-imino-N-methyl-N-propylpyridine-1-carboximidamide.
| Compound Name | 5-fluoro-2-imino-N-methyl-N-propylpyridine-1-carboximidamide |
|---|---|
| PubChem CID | 123619854 |
| Molecular Formula | C10H15FN4 |
| Molecular Weight | 210.26 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | 5-fluoro-2-imino-N-methyl-N-propylpyridine-1-carboximidamide |
| SMILES | [H]/N=C(\N(C)CCC)n1cc(F)cc/c1=N\[H] |
| InChI | InChI=1S/C10H15FN4/c1-3-6-14(2)10(13)15-7-8(11)4-5-9(15)12/h4-5,7,12-13H,3,6H2,1-2H3/b12-9+,13-10+ |
| InChIKey | ORSTZOKDCBJTBV-JOWSBRCASA-N |
| XLogP | 1.23 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.26 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|