About 5-fluoro-2-imino-N'-methylpyridine-1-carboximidamide
5-fluoro-2-imino-N'-methylpyridine-1-carboximidamide (PubChem CID 123588784) has the molecular formula C7H9FN4
and a molecular weight of 168.17 g/mol. Its IUPAC name is 5-fluoro-2-imino-N'-methylpyridine-1-carboximidamide.
Molecular Properties
| Compound Name | 5-fluoro-2-imino-N'-methylpyridine-1-carboximidamide |
| PubChem CID | 123588784 |
| Molecular Formula | C7H9FN4 |
| Molecular Weight | 168.17 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | 5-fluoro-2-imino-N'-methylpyridine-1-carboximidamide |
| SMILES | [H]/N=c1\ccc(F)cn1/C(N)=N/C |
| InChI | InChI=1S/C7H9FN4/c1-11-7(10)12-4-5(8)2-3-6(12)9/h2-4,9H,1H3,(H2,10,11)/b9-6+ |
| InChIKey | HZOUIUPPEFZDKZ-RMKNXTFCSA-N |
| XLogP | -0.10 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.17 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-2-imino-N'-methylpyridine-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2-imino-N'-methylpyridine-1-carboximidamide?
The IUPAC name of 5-fluoro-2-imino-N'-methylpyridine-1-carboximidamide (CID 123588784) is 5-fluoro-2-imino-N'-methylpyridine-1-carboximidamide.
What is the SMILES notation for 5-fluoro-2-imino-N'-methylpyridine-1-carboximidamide?
The canonical SMILES for 5-fluoro-2-imino-N'-methylpyridine-1-carboximidamide is [H]/N=c1\ccc(F)cn1/C(N)=N/C.
What is the InChIKey of 5-fluoro-2-imino-N'-methylpyridine-1-carboximidamide?
The InChIKey is HZOUIUPPEFZDKZ-RMKNXTFCSA-N. The full InChI is InChI=1S/C7H9FN4/c1-11-7(10)12-4-5(8)2-3-6(12)9/h2-4,9H,1H3,(H2,10,11)/b9-6+.
What are the key properties of 5-fluoro-2-imino-N'-methylpyridine-1-carboximidamide?
5-fluoro-2-imino-N'-methylpyridine-1-carboximidamide has a molecular weight of 168.17 g/mol, XLogP of -0.10, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2-imino-N'-methylpyridine-1-carboximidamide is sourced from PubChem (CID 123588784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).