C14H11F2N5O2 — CID 130309643
2-[[1-[3-(difluoromethoxy)phenyl]triazol-4-yl]methoxy]pyrimidine (PubChem CID 130309643) has the molecular formula C14H11F2N5O2 and a molecular weight of 319.27 g/mol. Its IUPAC name is 2-[[1-[3-(difluoromethoxy)phenyl]triazol-4-yl]methoxy]pyrimidine.
| Compound Name | 2-[[1-[3-(difluoromethoxy)phenyl]triazol-4-yl]methoxy]pyrimidine |
|---|---|
| PubChem CID | 130309643 |
| Molecular Formula | C14H11F2N5O2 |
| Molecular Weight | 319.27 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | 2-[[1-[3-(difluoromethoxy)phenyl]triazol-4-yl]methoxy]pyrimidine |
| SMILES | FC(F)Oc1cccc(-n2cc(COc3ncccn3)nn2)c1 |
| InChI | InChI=1S/C14H11F2N5O2/c15-13(16)23-12-4-1-3-11(7-12)21-8-10(19-20-21)9-22-14-17-5-2-6-18-14/h1-8,13H,9H2 |
| InChIKey | JEJWZFXCYJKDPA-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 74.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.27 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |