C23H31F3N2O4S — CID 130310310
N-[(2R,3S)-1-(cyclopropanecarbonyl)-2-[[4-(2,3,6-trifluorophenyl)cyclohexyl]oxymethyl]piperidin-3-yl]methanesulfonamide (PubChem CID 130310310) has the molecular formula C23H31F3N2O4S and a molecular weight of 488.57 g/mol. Its IUPAC name is N-[(2R,3S)-1-(cyclopropanecarbonyl)-2-[[4-(2,3,6-trifluorophenyl)cyclohexyl]oxymethyl]piperidin-3-yl]methanesulfonamide.
| Compound Name | N-[(2R,3S)-1-(cyclopropanecarbonyl)-2-[[4-(2,3,6-trifluorophenyl)cyclohexyl]oxymethyl]piperidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 130310310 |
| Molecular Formula | C23H31F3N2O4S |
| Molecular Weight | 488.57 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | N-[(2R,3S)-1-(cyclopropanecarbonyl)-2-[[4-(2,3,6-trifluorophenyl)cyclohexyl]oxymethyl]piperidin-3-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)N[C@H]1CCCN(C(=O)C2CC2)[C@H]1COC1CCC(c2c(F)ccc(F)c2F)CC1 |
| InChI | InChI=1S/C23H31F3N2O4S/c1-33(30,31)27-19-3-2-12-28(23(29)15-4-5-15)20(19)13-32-16-8-6-14(7-9-16)21-17(24)10-11-18(25)22(21)26/h10-11,14-16,19-20,27H,2-9,12-13H2,1H3/t14?,16?,19-,20-/m0/s1 |
| InChIKey | CSKNLLRCLSVFLI-PNQJHCTGSA-N |
| XLogP | 3.47 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.57 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|