C22H29F3N2O2 — CID 166854390
[3-amino-2-[[4-(2,3,6-trifluorophenyl)cyclohexyl]oxymethyl]piperidin-1-yl]-cyclopropylmethanone (PubChem CID 166854390) has the molecular formula C22H29F3N2O2 and a molecular weight of 410.48 g/mol. Its IUPAC name is [3-amino-2-[[4-(2,3,6-trifluorophenyl)cyclohexyl]oxymethyl]piperidin-1-yl]-cyclopropylmethanone.
| Compound Name | [3-amino-2-[[4-(2,3,6-trifluorophenyl)cyclohexyl]oxymethyl]piperidin-1-yl]-cyclopropylmethanone |
|---|---|
| PubChem CID | 166854390 |
| Molecular Formula | C22H29F3N2O2 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | [3-amino-2-[[4-(2,3,6-trifluorophenyl)cyclohexyl]oxymethyl]piperidin-1-yl]-cyclopropylmethanone |
| SMILES | NC1CCCN(C(=O)C2CC2)C1COC1CCC(c2c(F)ccc(F)c2F)CC1 |
| InChI | InChI=1S/C22H29F3N2O2/c23-16-9-10-17(24)21(25)20(16)13-5-7-15(8-6-13)29-12-19-18(26)2-1-11-27(19)22(28)14-3-4-14/h9-10,13-15,18-19H,1-8,11-12,26H2 |
| InChIKey | GUVKMLPXKYLFBP-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|