C24H31F3N4O2 — CID 170656026
N-ethyl-3-(1H-pyrazol-5-yl)-2-[[4-(2,3,6-trifluorophenyl)cyclohexyl]oxymethyl]piperidine-1-carboxamide (PubChem CID 170656026) has the molecular formula C24H31F3N4O2 and a molecular weight of 464.53 g/mol. Its IUPAC name is N-ethyl-3-(1H-pyrazol-5-yl)-2-[[4-(2,3,6-trifluorophenyl)cyclohexyl]oxymethyl]piperidine-1-carboxamide.
| Compound Name | N-ethyl-3-(1H-pyrazol-5-yl)-2-[[4-(2,3,6-trifluorophenyl)cyclohexyl]oxymethyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 170656026 |
| Molecular Formula | C24H31F3N4O2 |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | N-ethyl-3-(1H-pyrazol-5-yl)-2-[[4-(2,3,6-trifluorophenyl)cyclohexyl]oxymethyl]piperidine-1-carboxamide |
| SMILES | CCNC(=O)N1CCCC(c2ccn[nH]2)C1COC1CCC(c2c(F)ccc(F)c2F)CC1 |
| InChI | InChI=1S/C24H31F3N4O2/c1-2-28-24(32)31-13-3-4-17(20-11-12-29-30-20)21(31)14-33-16-7-5-15(6-8-16)22-18(25)9-10-19(26)23(22)27/h9-12,15-17,21H,2-8,13-14H2,1H3,(H,28,32)(H,29,30) |
| InChIKey | VBJTZLRCAQZWBC-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|