C23H31N3O3 — CID 163392222
methyl (2R)-2-[(4-phenylcyclohexyl)oxymethyl]-3-(1H-pyrazol-5-yl)piperidine-1-carboxylate (PubChem CID 163392222) has the molecular formula C23H31N3O3 and a molecular weight of 397.52 g/mol. Its IUPAC name is methyl (2R)-2-[(4-phenylcyclohexyl)oxymethyl]-3-(1H-pyrazol-5-yl)piperidine-1-carboxylate.
| Compound Name | methyl (2R)-2-[(4-phenylcyclohexyl)oxymethyl]-3-(1H-pyrazol-5-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 163392222 |
| Molecular Formula | C23H31N3O3 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | methyl (2R)-2-[(4-phenylcyclohexyl)oxymethyl]-3-(1H-pyrazol-5-yl)piperidine-1-carboxylate |
| SMILES | COC(=O)N1CCCC(c2ccn[nH]2)[C@@H]1COC1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C23H31N3O3/c1-28-23(27)26-15-5-8-20(21-13-14-24-25-21)22(26)16-29-19-11-9-18(10-12-19)17-6-3-2-4-7-17/h2-4,6-7,13-14,18-20,22H,5,8-12,15-16H2,1H3,(H,24,25)/t18?,19?,20?,22-/m0/s1 |
| InChIKey | GKWXHBLTQBZSKD-JJECGNGTSA-N |
| XLogP | 4.47 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |