C26H33N3O3 — CID 163392280
but-2-ynyl (2R,3S)-2-[(4-phenylcyclohexyl)oxymethyl]-3-(1H-pyrazol-5-yl)piperidine-1-carboxylate (PubChem CID 163392280) has the molecular formula C26H33N3O3 and a molecular weight of 435.57 g/mol. Its IUPAC name is but-2-ynyl (2R,3S)-2-[(4-phenylcyclohexyl)oxymethyl]-3-(1H-pyrazol-5-yl)piperidine-1-carboxylate.
| Compound Name | but-2-ynyl (2R,3S)-2-[(4-phenylcyclohexyl)oxymethyl]-3-(1H-pyrazol-5-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 163392280 |
| Molecular Formula | C26H33N3O3 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.25 |
| IUPAC Name | but-2-ynyl (2R,3S)-2-[(4-phenylcyclohexyl)oxymethyl]-3-(1H-pyrazol-5-yl)piperidine-1-carboxylate |
| SMILES | CC#CCOC(=O)N1CCC[C@H](c2ccn[nH]2)[C@@H]1COC1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C26H33N3O3/c1-2-3-18-31-26(30)29-17-7-10-23(24-15-16-27-28-24)25(29)19-32-22-13-11-21(12-14-22)20-8-5-4-6-9-20/h4-6,8-9,15-16,21-23,25H,7,10-14,17-19H2,1H3,(H,27,28)/t21?,22?,23-,25+/m1/s1 |
| InChIKey | KMFCESKRKCFNLQ-WZCQUIKNSA-N |
| XLogP | 4.86 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|