C20H27F3N2O3 — CID 166854002
methyl (2R)-3-amino-2-[[4-(2,3,5-trifluorophenyl)cyclohexyl]oxymethyl]piperidine-1-carboxylate (PubChem CID 166854002) has the molecular formula C20H27F3N2O3 and a molecular weight of 400.44 g/mol. Its IUPAC name is methyl (2R)-3-amino-2-[[4-(2,3,5-trifluorophenyl)cyclohexyl]oxymethyl]piperidine-1-carboxylate.
| Compound Name | methyl (2R)-3-amino-2-[[4-(2,3,5-trifluorophenyl)cyclohexyl]oxymethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 166854002 |
| Molecular Formula | C20H27F3N2O3 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | methyl (2R)-3-amino-2-[[4-(2,3,5-trifluorophenyl)cyclohexyl]oxymethyl]piperidine-1-carboxylate |
| SMILES | COC(=O)N1CCCC(N)[C@@H]1COC1CCC(c2cc(F)cc(F)c2F)CC1 |
| InChI | InChI=1S/C20H27F3N2O3/c1-27-20(26)25-8-2-3-17(24)18(25)11-28-14-6-4-12(5-7-14)15-9-13(21)10-16(22)19(15)23/h9-10,12,14,17-18H,2-8,11,24H2,1H3/t12?,14?,17?,18-/m0/s1 |
| InChIKey | WSUWVFFDQIRAQA-NSHWSYMASA-N |
| XLogP | 3.70 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|