C20H15N7O3 — CID 130312660
(Z)-2-methyl-3-[2-(methylideneamino)-5-nitro-4-pyridin-4-yloxyphenyl]-3-(pyrimidin-2-ylamino)prop-2-enenitrile (PubChem CID 130312660) has the molecular formula C20H15N7O3 and a molecular weight of 401.39 g/mol. Its IUPAC name is (Z)-2-methyl-3-[2-(methylideneamino)-5-nitro-4-pyridin-4-yloxyphenyl]-3-(pyrimidin-2-ylamino)prop-2-enenitrile.
| Compound Name | (Z)-2-methyl-3-[2-(methylideneamino)-5-nitro-4-pyridin-4-yloxyphenyl]-3-(pyrimidin-2-ylamino)prop-2-enenitrile |
|---|---|
| PubChem CID | 130312660 |
| Molecular Formula | C20H15N7O3 |
| Molecular Weight | 401.39 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | (Z)-2-methyl-3-[2-(methylideneamino)-5-nitro-4-pyridin-4-yloxyphenyl]-3-(pyrimidin-2-ylamino)prop-2-enenitrile |
| SMILES | C=Nc1cc(Oc2ccncc2)c([N+](=O)[O-])cc1/C(Nc1ncccn1)=C(\C)C#N |
| InChI | InChI=1S/C20H15N7O3/c1-13(12-21)19(26-20-24-6-3-7-25-20)15-10-17(27(28)29)18(11-16(15)22-2)30-14-4-8-23-9-5-14/h3-11H,2H2,1H3,(H,24,25,26)/b19-13- |
| InChIKey | OWRQCXGFBKJGDO-UYRXBGFRSA-N |
| XLogP | 4.27 |
| TPSA | 139.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.39 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|