C11H11IN2O2 — CID 130314126
3-iodo-5-methylspiro[3H-pyrido[3,2-b][1,4]oxazepine-2,1'-cyclopropane]-4-one (PubChem CID 130314126) has the molecular formula C11H11IN2O2 and a molecular weight of 330.13 g/mol. Its IUPAC name is 3-iodo-5-methylspiro[3H-pyrido[3,2-b][1,4]oxazepine-2,1'-cyclopropane]-4-one.
| Compound Name | 3-iodo-5-methylspiro[3H-pyrido[3,2-b][1,4]oxazepine-2,1'-cyclopropane]-4-one |
|---|---|
| PubChem CID | 130314126 |
| Molecular Formula | C11H11IN2O2 |
| Molecular Weight | 330.13 g/mol |
| Exact Mass | 329.99 |
| IUPAC Name | 3-iodo-5-methylspiro[3H-pyrido[3,2-b][1,4]oxazepine-2,1'-cyclopropane]-4-one |
| SMILES | CN1C(=O)C(I)C2(CC2)Oc2cccnc21 |
| InChI | InChI=1S/C11H11IN2O2/c1-14-9-7(3-2-6-13-9)16-11(4-5-11)8(12)10(14)15/h2-3,6,8H,4-5H2,1H3 |
| InChIKey | CKOBXIPVKLYWOK-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.13 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|