C21H42N2O — CID 130316337
1,3-bis[cyclooctyl(methyl)amino]propan-2-ol (PubChem CID 130316337) has the molecular formula C21H42N2O and a molecular weight of 338.58 g/mol. Its IUPAC name is 1,3-bis[cyclooctyl(methyl)amino]propan-2-ol.
| Compound Name | 1,3-bis[cyclooctyl(methyl)amino]propan-2-ol |
|---|---|
| PubChem CID | 130316337 |
| Molecular Formula | C21H42N2O |
| Molecular Weight | 338.58 g/mol |
| Exact Mass | 338.33 |
| IUPAC Name | 1,3-bis[cyclooctyl(methyl)amino]propan-2-ol |
| SMILES | CN(CC(O)CN(C)C1CCCCCCC1)C1CCCCCCC1 |
| InChI | InChI=1S/C21H42N2O/c1-22(19-13-9-5-3-6-10-14-19)17-21(24)18-23(2)20-15-11-7-4-8-12-16-20/h19-21,24H,3-18H2,1-2H3 |
| InChIKey | MDJLZWJMMLAGIV-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.58 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |