About methane;methanol;N-methyl-N-(2-methylpropyl)cyclobutanamine
methane;methanol;N-methyl-N-(2-methylpropyl)cyclobutanamine (PubChem CID 155582647) has the molecular formula C11H27NO
and a molecular weight of 189.34 g/mol. Its IUPAC name is methane;methanol;N-methyl-N-(2-methylpropyl)cyclobutanamine.
Molecular Properties
| Compound Name | methane;methanol;N-methyl-N-(2-methylpropyl)cyclobutanamine |
| PubChem CID | 155582647 |
| Molecular Formula | C11H27NO |
| Molecular Weight | 189.34 g/mol |
| Exact Mass | 189.21 |
| IUPAC Name | methane;methanol;N-methyl-N-(2-methylpropyl)cyclobutanamine |
| SMILES | C.CC(C)CN(C)C1CCC1.CO |
| InChI | InChI=1S/C9H19N.CH4O.CH4/c1-8(2)7-10(3)9-5-4-6-9;1-2;/h8-9H,4-7H2,1-3H3;2H,1H3;1H4 |
| InChIKey | LPWWOSHCBVMSCS-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.34 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methane;methanol;N-methyl-N-(2-methylpropyl)cyclobutanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;methanol;N-methyl-N-(2-methylpropyl)cyclobutanamine?
The IUPAC name of methane;methanol;N-methyl-N-(2-methylpropyl)cyclobutanamine (CID 155582647) is methane;methanol;N-methyl-N-(2-methylpropyl)cyclobutanamine.
What is the SMILES notation for methane;methanol;N-methyl-N-(2-methylpropyl)cyclobutanamine?
The canonical SMILES for methane;methanol;N-methyl-N-(2-methylpropyl)cyclobutanamine is C.CC(C)CN(C)C1CCC1.CO.
What is the InChIKey of methane;methanol;N-methyl-N-(2-methylpropyl)cyclobutanamine?
The InChIKey is LPWWOSHCBVMSCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N.CH4O.CH4/c1-8(2)7-10(3)9-5-4-6-9;1-2;/h8-9H,4-7H2,1-3H3;2H,1H3;1H4.
What are the key properties of methane;methanol;N-methyl-N-(2-methylpropyl)cyclobutanamine?
methane;methanol;N-methyl-N-(2-methylpropyl)cyclobutanamine has a molecular weight of 189.34 g/mol, XLogP of 2.37, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methane;methanol;N-methyl-N-(2-methylpropyl)cyclobutanamine is sourced from PubChem (CID 155582647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).