C14H30N2 — CID 138728386
N-methyl-N,1-bis(2-methylpropyl)piperidin-4-amine (PubChem CID 138728386) has the molecular formula C14H30N2 and a molecular weight of 226.41 g/mol. Its IUPAC name is N-methyl-N,1-bis(2-methylpropyl)piperidin-4-amine.
| Compound Name | N-methyl-N,1-bis(2-methylpropyl)piperidin-4-amine |
|---|---|
| PubChem CID | 138728386 |
| Molecular Formula | C14H30N2 |
| Molecular Weight | 226.41 g/mol |
| Exact Mass | 226.24 |
| IUPAC Name | N-methyl-N,1-bis(2-methylpropyl)piperidin-4-amine |
| SMILES | CC(C)CN1CCC(N(C)CC(C)C)CC1 |
| InChI | InChI=1S/C14H30N2/c1-12(2)10-15(5)14-6-8-16(9-7-14)11-13(3)4/h12-14H,6-11H2,1-5H3 |
| InChIKey | POEQIXAMRIXHET-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.41 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |