C13H28N2 — CID 80544341
N-cycloheptyl-N,2-dimethylbutane-1,4-diamine (PubChem CID 80544341) has the molecular formula C13H28N2 and a molecular weight of 212.38 g/mol. Its IUPAC name is N-cycloheptyl-N,2-dimethylbutane-1,4-diamine.
| Compound Name | N-cycloheptyl-N,2-dimethylbutane-1,4-diamine |
|---|---|
| PubChem CID | 80544341 |
| Molecular Formula | C13H28N2 |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.23 |
| IUPAC Name | N-cycloheptyl-N,2-dimethylbutane-1,4-diamine |
| SMILES | CC(CCN)CN(C)C1CCCCCC1 |
| InChI | InChI=1S/C13H28N2/c1-12(9-10-14)11-15(2)13-7-5-3-4-6-8-13/h12-13H,3-11,14H2,1-2H3 |
| InChIKey | NWTVUMVRHKXGCB-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |